cas: 50609-01-3 — see every product listed under this CAS number, including other names
4-(2-(Pyrrolidin-1-yl)ethoxy)aniline 95% (CAS 50609-01-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A144803-100mg |
| cas | 50609-01-3 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 281.38 Pln | |
| Ambeed | 250mg | 381.50 Pln | |
| Ambeed | 1g | 854.31 Pln | |
| Ambeed | 5g | 2584.25 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A144803 |
4-(2-pyrrolidin-1-ylethoxy)aniline (CAS 50609-01-3) is a chemical compound with the molecular formula C12H18N2O and a molecular weight of 206.28 g/mol. IUPAC name: 4-(2-pyrrolidin-1-ylethoxy)aniline. InChIKey: OTYZNDKWNPQQJP-UHFFFAOYSA-N.
| Molecular formula | C12H18N2O |
|---|---|
| Molecular weight | 206.28 g/mol |
| IUPAC name | 4-(2-pyrrolidin-1-ylethoxy)aniline |
| InChIKey | OTYZNDKWNPQQJP-UHFFFAOYSA-N |
| SMILES | C1CCN(C1)CCOC2=CC=C(C=C2)N |
Computed by PubChem (NCBI)