cas: 255051-14-0 — see every product listed under this CAS number, including other names
4-(2-(Trifluoromethyl)phenyl)piperidine hydrochloride 98% (CAS 255051-14-0) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A372674-250mg |
| cas | 255051-14-0 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 303.62 Pln | |
| Ambeed | 1g | 648.50 Pln | |
| Ambeed | 5g | 1850.00 Pln | |
| Ambeed | 25g | 4876.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A372674 |
4-[2-(trifluoromethyl)phenyl]piperidine;hydrochloride (CAS 255051-14-0) is a chemical compound with the molecular formula C12H15ClF3N and a molecular weight of 265.70 g/mol. IUPAC name: 4-[2-(trifluoromethyl)phenyl]piperidine;hydrochloride. InChIKey: BZYIRYKJNSACFP-UHFFFAOYSA-N.
| Molecular formula | C12H15ClF3N |
|---|---|
| Molecular weight | 265.70 g/mol |
| IUPAC name | 4-[2-(trifluoromethyl)phenyl]piperidine;hydrochloride |
| InChIKey | BZYIRYKJNSACFP-UHFFFAOYSA-N |
| SMILES | C1CNCCC1C2=CC=CC=C2C(F)(F)F.Cl |
Computed by PubChem (NCBI)