4-(2-(Trifluoromethyl)phenyl)piperidine hydrochloride, 98%
cas: 255051-14-0 — see every product listed under this CAS number, including other names
4-(2-(Trifluoromethyl)phenyl)piperidine hydrochloride, 98% (CAS 255051-14-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 100g. Offered by: Fluorochem, Ambeed, BLDpharm.
| brand | Fluorochem |
|---|---|
| catalog number | F225197-100MG |
| cas | 255051-14-0 |
| size | 100mg |
| availability | In Stock China |
Documents:
Safety Data Sheet (MSDS)
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 180.16 Pln | |
| Fluorochem | 250mg | 299.91 Pln | |
| Fluorochem | 1g | 617.51 Pln | |
| Fluorochem | 5g | 1742.11 Pln | |
| Fluorochem | 10g | 2325.24 Pln | |
| Fluorochem | 25g | 5043.03 Pln | |
| Ambeed | 250mg | 309.19 Pln | |
| Ambeed | 1g | 654.06 Pln | |
| Ambeed | 5g | 1866.69 Pln | |
| Ambeed | 25g | 4926.06 Pln | |
| Ambeed | 100g | 17074.56 Pln | |
| BLDpharm | 250mg | 325.47 Pln | |
| BLDpharm | 1g | 697.56 Pln | |
| BLDpharm | 5g | 2008.21 Pln | |
| BLDpharm | 25g | 5307.04 Pln | |
| BLDpharm | 100g | 18402.43 Pln |
properties
| purity | 98% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 2-3 weeks |
| category | Odczynniki chemiczne |
4-[2-(trifluoromethyl)phenyl]piperidine;hydrochloride (CAS 255051-14-0) is a chemical compound with the molecular formula C12H15ClF3N and a molecular weight of 265.70 g/mol. IUPAC name: 4-[2-(trifluoromethyl)phenyl]piperidine;hydrochloride. InChIKey: BZYIRYKJNSACFP-UHFFFAOYSA-N.
| Molecular formula | C12H15ClF3N |
|---|---|
| Molecular weight | 265.70 g/mol |
| IUPAC name | 4-[2-(trifluoromethyl)phenyl]piperidine;hydrochloride |
| InChIKey | BZYIRYKJNSACFP-UHFFFAOYSA-N |
| SMILES | C1CNCCC1C2=CC=CC=C2C(F)(F)F.Cl |
Computed by PubChem (NCBI)
Synonyms:
4-[2-(trifluoromethyl)phenyl]piperidine hydrochloride, 4-(2-trifluoromethyl-phenyl)-piperidine hydrochloride, 4-[2-(trifluoromethyl)phenyl]piperidine;hydrochloride, 4-[2-(trifluoromethyl)ph, 4-(2-(trifluoromethyl)phenyl)piperidinehydrochloride, 4-(2- trifluoromethyl-phenyl)-piperidine hydrochloride, 4-(2-trifluoromethylphenyl)-piperidine hydrochloride, AldrichCPR, 4-[2-(Trifluoromethyl)phenyl]piperidine--hydrogen chloride (1/1)