CAS 941717-01-7 is the registry number for 4-(2-Bromophenyl)-2-methyl-1,3-thiazole, 97% . Offered by: Thermo Scientific. Available pack sizes: 1g, 5g.
4-(2-bromophenyl)-2-methyl-1,3-thiazole (CAS 941717-01-7) is a chemical compound with the molecular formula C10H8BrNS and a molecular weight of 254.15 g/mol. IUPAC name: 4-(2-bromophenyl)-2-methyl-1,3-thiazole. InChIKey: SXJQVZDDCODIST-UHFFFAOYSA-N.
| Molecular formula | C10H8BrNS |
|---|---|
| Molecular weight | 254.15 g/mol |
| IUPAC name | 4-(2-bromophenyl)-2-methyl-1,3-thiazole |
| InChIKey | SXJQVZDDCODIST-UHFFFAOYSA-N |
| SMILES | CC1=NC(=CS1)C2=CC=CC=C2Br |
Computed by PubChem (NCBI)