CAS 78502-83-7 is the registry number for 4-(Bromomethyl)-2-phenylthiazole, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4-(bromomethyl)-2-phenyl-1,3-thiazole (CAS 78502-83-7) is a chemical compound with the molecular formula C10H8BrNS and a molecular weight of 254.15 g/mol. IUPAC name: 4-(bromomethyl)-2-phenyl-1,3-thiazole. InChIKey: QSXTXXYCMUDHNM-UHFFFAOYSA-N.
| Molecular formula | C10H8BrNS |
|---|---|
| Molecular weight | 254.15 g/mol |
| IUPAC name | 4-(bromomethyl)-2-phenyl-1,3-thiazole |
| InChIKey | QSXTXXYCMUDHNM-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NC(=CS2)CBr |
Computed by PubChem (NCBI)