CAS 210490-49-6 is the registry number for 4-Bromo-5-methyl-2-phenylthiazole, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g, 10g.
4-bromo-5-methyl-2-phenyl-1,3-thiazole (CAS 210490-49-6) is a chemical compound with the molecular formula C10H8BrNS and a molecular weight of 254.15 g/mol. IUPAC name: 4-bromo-5-methyl-2-phenyl-1,3-thiazole. InChIKey: ULTGQQSDJYHXLA-UHFFFAOYSA-N.
| Molecular formula | C10H8BrNS |
|---|---|
| Molecular weight | 254.15 g/mol |
| IUPAC name | 4-bromo-5-methyl-2-phenyl-1,3-thiazole |
| InChIKey | ULTGQQSDJYHXLA-UHFFFAOYSA-N |
| SMILES | CC1=C(N=C(S1)C2=CC=CC=C2)Br |
Computed by PubChem (NCBI)