CAS 903522-18-9 appears in our catalog under these names: 2-(3-Bromo-4-methylphenyl)-1,3-thiazole, 98%, 2-(3-Bromo-4-methylphenyl)thiazole, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 25g, 10g.
2-(3-bromo-4-methylphenyl)-1,3-thiazole (CAS 903522-18-9) is a chemical compound with the molecular formula C10H8BrNS and a molecular weight of 254.15 g/mol. IUPAC name: 2-(3-bromo-4-methylphenyl)-1,3-thiazole. InChIKey: HJELXNDQCXHNFF-UHFFFAOYSA-N.
| Molecular formula | C10H8BrNS |
|---|---|
| Molecular weight | 254.15 g/mol |
| IUPAC name | 2-(3-bromo-4-methylphenyl)-1,3-thiazole |
| InChIKey | HJELXNDQCXHNFF-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)C2=NC=CS2)Br |
Computed by PubChem (NCBI)