cas: 55435-71-7 — see every product listed under this CAS number, including other names
4-(2-Chloro-4-nitrophenyl)morpholine, 96%, 96% (CAS 55435-71-7) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11DD8Q-1g |
| cas | 55435-71-7 |
| size | 1g |
| availability | 8g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 122.00 Pln | |
| Chemat | 5g | 309.20 Pln |
| purity | 96% |
|---|---|
| delivery time | 3 weeks |
4-(2-chloro-4-nitrophenyl)morpholine (CAS 55435-71-7) is a chemical compound with the molecular formula C10H11ClN2O3 and a molecular weight of 242.66 g/mol. IUPAC name: 4-(2-chloro-4-nitrophenyl)morpholine. InChIKey: ZPKGWYXJULKUEH-UHFFFAOYSA-N.
| Molecular formula | C10H11ClN2O3 |
|---|---|
| Molecular weight | 242.66 g/mol |
| IUPAC name | 4-(2-chloro-4-nitrophenyl)morpholine |
| InChIKey | ZPKGWYXJULKUEH-UHFFFAOYSA-N |
| SMILES | C1COCCN1C2=C(C=C(C=C2)[N+](=O)[O-])Cl |
Computed by PubChem (NCBI)