CAS 851169-10-3 is the registry number for 2-Chloro-n-(2,3-dimethyl-6-nitrophenyl)acetamide, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.
2-chloro-N-(2,3-dimethyl-6-nitrophenyl)acetamide (CAS 851169-10-3) is a chemical compound with the molecular formula C10H11ClN2O3 and a molecular weight of 242.66 g/mol. IUPAC name: 2-chloro-N-(2,3-dimethyl-6-nitrophenyl)acetamide. InChIKey: IPBTWALANVJTNV-UHFFFAOYSA-N.
| Molecular formula | C10H11ClN2O3 |
|---|---|
| Molecular weight | 242.66 g/mol |
| IUPAC name | 2-chloro-N-(2,3-dimethyl-6-nitrophenyl)acetamide |
| InChIKey | IPBTWALANVJTNV-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=C(C=C1)[N+](=O)[O-])NC(=O)CCl)C |
Computed by PubChem (NCBI)