Products 851169-10-3

CAS 851169-10-3 is the registry number for 2-Chloro-n-(2,3-dimethyl-6-nitrophenyl)acetamide, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.

Structural formula: {0} (CAS {1})

2-chloro-N-(2,3-dimethyl-6-nitrophenyl)acetamide (CAS 851169-10-3) is a chemical compound with the molecular formula C10H11ClN2O3 and a molecular weight of 242.66 g/mol. IUPAC name: 2-chloro-N-(2,3-dimethyl-6-nitrophenyl)acetamide. InChIKey: IPBTWALANVJTNV-UHFFFAOYSA-N.

Identity
Molecular formulaC10H11ClN2O3
Molecular weight242.66 g/mol
IUPAC name2-chloro-N-(2,3-dimethyl-6-nitrophenyl)acetamide
InChIKeyIPBTWALANVJTNV-UHFFFAOYSA-N
SMILESCC1=C(C(=C(C=C1)[N+](=O)[O-])NC(=O)CCl)C

Computed by PubChem (NCBI)