CAS 65976-60-5 appears in our catalog under these names: 4-(4-Chloro-2-nitrophenyl)morpholine, 95%, 4-(4-chloro-2-nitrophenyl)morpholine. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 250mg, 5g, 1g.
4-(4-chloro-2-nitrophenyl)morpholine (CAS 65976-60-5) is a chemical compound with the molecular formula C10H11ClN2O3 and a molecular weight of 242.66 g/mol. IUPAC name: 4-(4-chloro-2-nitrophenyl)morpholine. InChIKey: KJISHWYSNGQNFM-UHFFFAOYSA-N.
| Molecular formula | C10H11ClN2O3 |
|---|---|
| Molecular weight | 242.66 g/mol |
| IUPAC name | 4-(4-chloro-2-nitrophenyl)morpholine |
| InChIKey | KJISHWYSNGQNFM-UHFFFAOYSA-N |
| SMILES | C1COCCN1C2=C(C=C(C=C2)Cl)[N+](=O)[O-] |
Computed by PubChem (NCBI)