Products 1000018-00-7
CAS 1000018-00-7 is the registry number for N-(1,3-Benzodioxol-5-yl)-n'-(2-chloroethyl)urea, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
1-(1,3-benzodioxol-5-yl)-3-(2-chloroethyl)urea (CAS 1000018-00-7) is a chemical compound with the molecular formula C10H11ClN2O3 and a molecular weight of 242.66 g/mol. IUPAC name: 1-(1,3-benzodioxol-5-yl)-3-(2-chloroethyl)urea. InChIKey: BTFJOSDYSXVDDD-UHFFFAOYSA-N.
| Molecular formula | C10H11ClN2O3 |
|---|---|
| Molecular weight | 242.66 g/mol |
| IUPAC name | 1-(1,3-benzodioxol-5-yl)-3-(2-chloroethyl)urea |
| InChIKey | BTFJOSDYSXVDDD-UHFFFAOYSA-N |
| SMILES | C1OC2=C(O1)C=C(C=C2)NC(=O)NCCCl |
Computed by PubChem (NCBI)