cas: 36775-23-2 — see every product listed under this CAS number, including other names
4-(2-Chloroacetamido)-2,2,6,6-tetramethylpiperidine1-oxyl (CAS 36775-23-2) is a chemical reagent available from Chemat. Available pack sizes: 5g, 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114JZC-5g |
| cas | 36775-23-2 |
| size | 5g |
| availability | 15g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 5g | 1701.20 Pln | |
| Chemat | 100mg | 160.40 Pln | |
| Chemat | 250mg | 261.20 Pln | |
| Chemat | 1g | 386.00 Pln |
| delivery time | 3 weeks |
|---|
2-chloro-N-(1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl)acetamide (CAS 36775-23-2) is a chemical compound with the molecular formula C11H21ClN2O2 and a molecular weight of 248.75 g/mol. IUPAC name: 2-chloro-N-(1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl)acetamide. InChIKey: ICXMAAHRVIPICX-UHFFFAOYSA-N.
| Molecular formula | C11H21ClN2O2 |
|---|---|
| Molecular weight | 248.75 g/mol |
| IUPAC name | 2-chloro-N-(1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl)acetamide |
| InChIKey | ICXMAAHRVIPICX-UHFFFAOYSA-N |
| SMILES | CC1(CC(CC(N1O)(C)C)NC(=O)CCl)C |
Computed by PubChem (NCBI)