CAS 1909287-31-5 appears in our catalog under these names: tert-Butyl rac-(1s,2r,4r)-7-azabicyclo[2.2.1]hept-2-ylcarbamate hydrochloride, 95%, tert-butyl N-((1S,2R,4R)-7-azabicyclo(2.2.1)heptan-2-yl)carbamate hydrochloride, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 5g, 250mg, 1g, 100mg.
Tert-butyl N-[(1S,2R,4R)-7-azabicyclo[2.2.1]heptan-2-yl]carbamate;hydrochloride (CAS 1909287-31-5) is a chemical compound with the molecular formula C11H21ClN2O2 and a molecular weight of 248.75 g/mol. IUPAC name: tert-butyl N-[(1S,2R,4R)-7-azabicyclo[2.2.1]heptan-2-yl]carbamate;hydrochloride. InChIKey: CTUPSFKVOJMISH-RVKMJUHISA-N.
| Molecular formula | C11H21ClN2O2 |
|---|---|
| Molecular weight | 248.75 g/mol |
| IUPAC name | tert-butyl N-[(1S,2R,4R)-7-azabicyclo[2.2.1]heptan-2-yl]carbamate;hydrochloride |
| InChIKey | CTUPSFKVOJMISH-RVKMJUHISA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H]1C[C@H]2CC[C@@H]1N2.Cl |
Computed by PubChem (NCBI)