CAS 1841081-35-3 appears in our catalog under these names: tert-Butyl 2,6-diazaspiro[3.4]octane-6-carboxylate hydrochloride, 95%, tert–Butyl 2,6–diazaspiro(3·4)octane–6–carboxylate hydrochloride, tert-Butyl 2,7-diazaspiro(3.4)octane-7-carboxylate hydrochloride, tert-Butyl 2,6-diazaspiro[3.4]octane-6-carboxylate hydrochloride 97%, 2,6-Diazaspiro[3.4]octane-6-carboxylic acid, 1,1-dimethylethyl ester, hydrochloride (1:1), 97%, 97%. Offered by: Combi-blocks, GLPBio, Biosynth, Ambeed, Chemat. Available pack sizes: 250mg, 1g, 100mg, 10g, 500mg, 5g.
Tert-butyl 2,6-diazaspiro[3.4]octane-6-carboxylate;hydrochloride (CAS 1841081-35-3) is a chemical compound with the molecular formula C11H21ClN2O2 and a molecular weight of 248.75 g/mol. IUPAC name: tert-butyl 2,6-diazaspiro[3.4]octane-6-carboxylate;hydrochloride. InChIKey: WECWNXKIVSKUCQ-UHFFFAOYSA-N.
| Molecular formula | C11H21ClN2O2 |
|---|---|
| Molecular weight | 248.75 g/mol |
| IUPAC name | tert-butyl 2,6-diazaspiro[3.4]octane-6-carboxylate;hydrochloride |
| InChIKey | WECWNXKIVSKUCQ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC2(C1)CNC2.Cl |
Computed by PubChem (NCBI)