CAS 2098589-07-0 appears in our catalog under these names: tert-Butyl rac-(1s,2s,4r)-7-azabicyclo[2.2.1]hept-2-ylcarbamate hydrochloride, 95%, tert-Butyl N-((1S,2S,4R)-rel-7-azabicyclo(2.2.1)heptan-2-yl)carbamate hydrochloride, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 5g, 1g, 250mg.
Tert-butyl N-[(1S,2S,4R)-7-azabicyclo[2.2.1]heptan-2-yl]carbamate;hydrochloride (CAS 2098589-07-0) is a chemical compound with the molecular formula C11H21ClN2O2 and a molecular weight of 248.75 g/mol. IUPAC name: tert-butyl N-[(1S,2S,4R)-7-azabicyclo[2.2.1]heptan-2-yl]carbamate;hydrochloride. InChIKey: CTUPSFKVOJMISH-KEMIKLHMSA-N.
| Molecular formula | C11H21ClN2O2 |
|---|---|
| Molecular weight | 248.75 g/mol |
| IUPAC name | tert-butyl N-[(1S,2S,4R)-7-azabicyclo[2.2.1]heptan-2-yl]carbamate;hydrochloride |
| InChIKey | CTUPSFKVOJMISH-KEMIKLHMSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@H]1C[C@H]2CC[C@@H]1N2.Cl |
Computed by PubChem (NCBI)