cas: 269410-28-8 — see every product listed under this CAS number, including other names
4-(2-Ethoxy-2-oxoethoxy)phenylboronic acid, pinacol ester, 97%, 97% (CAS 269410-28-8) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch118MBK-250mg |
| cas | 269410-28-8 |
| size | 250mg |
| availability | 4g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 242.00 Pln | |
| Chemat | 1g | 515.60 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Ethyl 2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]acetate (CAS 269410-28-8) is a chemical compound with the molecular formula C16H23BO5 and a molecular weight of 306.2 g/mol. IUPAC name: ethyl 2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]acetate. InChIKey: IWVRBFCAALMWBP-UHFFFAOYSA-N.
| Molecular formula | C16H23BO5 |
|---|---|
| Molecular weight | 306.2 g/mol |
| IUPAC name | ethyl 2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]acetate |
| InChIKey | IWVRBFCAALMWBP-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=C(C=C2)OCC(=O)OCC |
Computed by PubChem (NCBI)