cas: 64671-29-0 — see every product listed under this CAS number, including other names
4-(2-FLUOROBENZOYL)PIPERIDINE HCL, 97% (CAS 64671-29-0) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 500mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F303089-250MG |
| cas | 64671-29-0 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 950.72 Pln | |
| Fluorochem | 500mg | 1403.69 Pln | |
| Fluorochem | 1g | 2059.71 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
(2-fluorophenyl)-piperidin-4-ylmethanone;hydrochloride (CAS 64671-29-0) is a chemical compound with the molecular formula C12H15ClFNO and a molecular weight of 243.70 g/mol. IUPAC name: (2-fluorophenyl)-piperidin-4-ylmethanone;hydrochloride. InChIKey: NOCFQMBSDJUUBB-UHFFFAOYSA-N.
| Molecular formula | C12H15ClFNO |
|---|---|
| Molecular weight | 243.70 g/mol |
| IUPAC name | (2-fluorophenyl)-piperidin-4-ylmethanone;hydrochloride |
| InChIKey | NOCFQMBSDJUUBB-UHFFFAOYSA-N |
| SMILES | C1CNCCC1C(=O)C2=CC=CC=C2F.Cl |
Computed by PubChem (NCBI)