cas: 2689-39-6 — see every product listed under this CAS number, including other names
4-(2-Fluoro-4-nitrophenyl)morpholine 98% (CAS 2689-39-6) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g, 100g, 500g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A794986-5g |
| cas | 2689-39-6 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 5g | 120.06 Pln | |
| Ambeed | 25g | 209.06 Pln | |
| Ambeed | 100g | 565.06 Pln | |
| Ambeed | 500g | 2322.81 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A794986 |
4-(2-fluoro-4-nitrophenyl)morpholine (CAS 2689-39-6) is a chemical compound with the molecular formula C10H11FN2O3 and a molecular weight of 226.20 g/mol. IUPAC name: 4-(2-fluoro-4-nitrophenyl)morpholine. InChIKey: ZEQCFSSBZPZEFJ-UHFFFAOYSA-N.
| Molecular formula | C10H11FN2O3 |
|---|---|
| Molecular weight | 226.20 g/mol |
| IUPAC name | 4-(2-fluoro-4-nitrophenyl)morpholine |
| InChIKey | ZEQCFSSBZPZEFJ-UHFFFAOYSA-N |
| SMILES | C1COCCN1C2=C(C=C(C=C2)[N+](=O)[O-])F |
Computed by PubChem (NCBI)