cas: 2689-39-6 — see every product listed under this CAS number, including other names
Morpholine, 4-(2-fluoro-4-nitrophenyl)-, 98%, 98% (CAS 2689-39-6) is a chemical reagent available from Chemat. Available pack sizes: 10g, 1g, 5g, 25g, 100g, 500g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11BEC9-10g |
| cas | 2689-39-6 |
| size | 10g |
| availability | 1500g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 10g | 107.60 Pln | |
| Chemat | 1g | 83.60 Pln | |
| Chemat | 5g | 83.60 Pln | |
| Chemat | 25g | 155.60 Pln | |
| Chemat | 100g | 338.00 Pln | |
| Chemat | 500g | 1180.80 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
4-(2-fluoro-4-nitrophenyl)morpholine (CAS 2689-39-6) is a chemical compound with the molecular formula C10H11FN2O3 and a molecular weight of 226.20 g/mol. IUPAC name: 4-(2-fluoro-4-nitrophenyl)morpholine. InChIKey: ZEQCFSSBZPZEFJ-UHFFFAOYSA-N.
| Molecular formula | C10H11FN2O3 |
|---|---|
| Molecular weight | 226.20 g/mol |
| IUPAC name | 4-(2-fluoro-4-nitrophenyl)morpholine |
| InChIKey | ZEQCFSSBZPZEFJ-UHFFFAOYSA-N |
| SMILES | C1COCCN1C2=C(C=C(C=C2)[N+](=O)[O-])F |
Computed by PubChem (NCBI)