cas: 25021-49-2 — see every product listed under this CAS number, including other names
4-(2-Methyl-1,3-thiazol-4-yl)aniline, 95% (CAS 25021-49-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 2.5g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F042206-100MG |
| cas | 25021-49-2 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 138.51 Pln | |
| Fluorochem | 250mg | 174.96 Pln | |
| Fluorochem | 1g | 232.23 Pln | |
| Fluorochem | 2.5g | 435.28 Pln | |
| Fluorochem | 5g | 815.36 Pln | |
| Fluorochem | 10g | 1565.09 Pln | |
| Fluorochem | 25g | 3106.22 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
4-(2-methyl-1,3-thiazol-4-yl)aniline (CAS 25021-49-2) is a chemical compound with the molecular formula C10H10N2S and a molecular weight of 190.27 g/mol. IUPAC name: 4-(2-methyl-1,3-thiazol-4-yl)aniline. InChIKey: JCRKEVDAEUPNAA-UHFFFAOYSA-N.
| Molecular formula | C10H10N2S |
|---|---|
| Molecular weight | 190.27 g/mol |
| IUPAC name | 4-(2-methyl-1,3-thiazol-4-yl)aniline |
| InChIKey | JCRKEVDAEUPNAA-UHFFFAOYSA-N |
| SMILES | CC1=NC(=CS1)C2=CC=C(C=C2)N |
Computed by PubChem (NCBI)