cas: 25021-49-2 — see every product listed under this CAS number, including other names
4-(2-Methylthiazol-4-yl)aniline 95% (CAS 25021-49-2) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A642056-250mg |
| cas | 25021-49-2 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 192.38 Pln | |
| Ambeed | 1g | 253.56 Pln | |
| Ambeed | 5g | 854.31 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A642056 |
4-(2-methyl-1,3-thiazol-4-yl)aniline (CAS 25021-49-2) is a chemical compound with the molecular formula C10H10N2S and a molecular weight of 190.27 g/mol. IUPAC name: 4-(2-methyl-1,3-thiazol-4-yl)aniline. InChIKey: JCRKEVDAEUPNAA-UHFFFAOYSA-N.
| Molecular formula | C10H10N2S |
|---|---|
| Molecular weight | 190.27 g/mol |
| IUPAC name | 4-(2-methyl-1,3-thiazol-4-yl)aniline |
| InChIKey | JCRKEVDAEUPNAA-UHFFFAOYSA-N |
| SMILES | CC1=NC(=CS1)C2=CC=C(C=C2)N |
Computed by PubChem (NCBI)