CAS 30686-73-8 appears in our catalog under these names: 4–(2–Methylthiazol–4–yl)phenol, 4-(2-Methyl-4-thiazolyl)phenol [for Biochemical Research], >98.0%(HPLC), 4-[4''-(2''-Methyl)thiazolyl]phenol, 4-(2-Methyl-4-thiazolyl)phenol [for Biochemical Research], 98%, 98%, 4-(2-Methyl-4-thiazolyl)phenol, 98.68%. Offered by: GLPBio, TCI, Chemat, MedChemExpress, Fluorochem. Available pack sizes: 1g, 250mg, 5g, 100mg, 500mg, 50mg, 10g, 100 mg.
4-(2-methyl-1,3-thiazol-4-yl)phenol (CAS 30686-73-8) is a chemical compound with the molecular formula C10H9NOS and a molecular weight of 191.25 g/mol. IUPAC name: 4-(2-methyl-1,3-thiazol-4-yl)phenol. InChIKey: HOAYTTLLVORNLA-UHFFFAOYSA-N.
| Molecular formula | C10H9NOS |
|---|---|
| Molecular weight | 191.25 g/mol |
| IUPAC name | 4-(2-methyl-1,3-thiazol-4-yl)phenol |
| InChIKey | HOAYTTLLVORNLA-UHFFFAOYSA-N |
| SMILES | CC1=NC(=CS1)C2=CC=C(C=C2)O |
Computed by PubChem (NCBI)