CAS 2639626-34-7 is the registry number for 2-Methyl-5-(1,3-thiazol-2-yl)phenol, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
2-methyl-5-(1,3-thiazol-2-yl)phenol (CAS 2639626-34-7) is a chemical compound with the molecular formula C10H9NOS and a molecular weight of 191.25 g/mol. IUPAC name: 2-methyl-5-(1,3-thiazol-2-yl)phenol. InChIKey: KGQGAYZFPDVGSQ-UHFFFAOYSA-N.
| Molecular formula | C10H9NOS |
|---|---|
| Molecular weight | 191.25 g/mol |
| IUPAC name | 2-methyl-5-(1,3-thiazol-2-yl)phenol |
| InChIKey | KGQGAYZFPDVGSQ-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)C2=NC=CS2)O |
Computed by PubChem (NCBI)