CAS 2103-90-4 appears in our catalog under these names: 4-(4-Methylphenyl)-2,3-dihydro-1,3-thiazol-2-one, 4-(4-Methylphenyl)-2,3-dihydro-1,3-thiazol-2-one, 95%, 4-(p-Tolyl)thiazol-2-ol, 97%. Offered by: Biosynth, Combi-blocks, AmBeed. Available pack sizes: 0,5g, 5g, 1g.
4-(4-methylphenyl)-3H-1,3-thiazol-2-one (CAS 2103-90-4) is a chemical compound with the molecular formula C10H9NOS and a molecular weight of 191.25 g/mol. IUPAC name: 4-(4-methylphenyl)-3H-1,3-thiazol-2-one. InChIKey: FKFCXWOMNWZZQG-UHFFFAOYSA-N.
| Molecular formula | C10H9NOS |
|---|---|
| Molecular weight | 191.25 g/mol |
| IUPAC name | 4-(4-methylphenyl)-3H-1,3-thiazol-2-one |
| InChIKey | FKFCXWOMNWZZQG-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C2=CSC(=O)N2 |
Computed by PubChem (NCBI)