4-(2-Pyridyl)aniline, 95%
cas: 18471-73-3 — see every product listed under this CAS number, including other names
4-(2-Pyridyl)aniline, 95% (CAS 18471-73-3) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 100mg. Offered by: Ambeed, BLDpharm, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A105694-250mg |
| cas | 18471-73-3 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 209.06 Pln | |
| Ambeed | 1g | 448.25 Pln | |
| Ambeed | 5g | 1065.69 Pln | |
| Ambeed | 10g | 1610.81 Pln | |
| BLDpharm | 100mg | 186.63 Pln | |
| BLDpharm | 250mg | 219.95 Pln | |
| BLDpharm | 1g | 475.41 Pln | |
| BLDpharm | 5g | 1141.84 Pln | |
| BLDpharm | 10g | 1730.53 Pln | |
| Fluorochem | 1g | 289.50 Pln | |
| Fluorochem | 5g | 1112.13 Pln | |
| Fluorochem | 10g | 1669.22 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
4-pyridin-2-ylaniline (CAS 18471-73-3) is a chemical compound with the molecular formula C11H10N2 and a molecular weight of 170.21 g/mol. IUPAC name: 4-pyridin-2-ylaniline. InChIKey: BXYRAPNURYRQSP-UHFFFAOYSA-N.
| Molecular formula | C11H10N2 |
|---|---|
| Molecular weight | 170.21 g/mol |
| IUPAC name | 4-pyridin-2-ylaniline |
| InChIKey | BXYRAPNURYRQSP-UHFFFAOYSA-N |
| SMILES | C1=CC=NC(=C1)C2=CC=C(C=C2)N |
Computed by PubChem (NCBI)