CAS 18471-73-3 appears in our catalog under these names: 4-(2-Pyridyl)aniline, 98%, 4-(2-Pyridyl)aniline, 95%. Offered by: Combi-blocks, Fluorochem, Ambeed. Available pack sizes: 10g, 100g, 5g, 25g, 1g, 250mg.
4-pyridin-2-ylaniline (CAS 18471-73-3) is a chemical compound with the molecular formula C11H10N2 and a molecular weight of 170.21 g/mol. IUPAC name: 4-pyridin-2-ylaniline. InChIKey: BXYRAPNURYRQSP-UHFFFAOYSA-N.
| Molecular formula | C11H10N2 |
|---|---|
| Molecular weight | 170.21 g/mol |
| IUPAC name | 4-pyridin-2-ylaniline |
| InChIKey | BXYRAPNURYRQSP-UHFFFAOYSA-N |
| SMILES | C1=CC=NC(=C1)C2=CC=C(C=C2)N |
Computed by PubChem (NCBI)