cas: 5333-34-6 — see every product listed under this CAS number, including other names
4-(3,4-Dimethoxyphenyl)-4-oxobutyric acid, 95% (CAS 5333-34-6) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F022996-250MG |
| cas | 5333-34-6 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 159.34 Pln | |
| Fluorochem | 1g | 258.26 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
4-(3,4-dimethoxyphenyl)-4-oxobutanoic acid (CAS 5333-34-6) is a chemical compound with the molecular formula C12H14O5 and a molecular weight of 238.24 g/mol. IUPAC name: 4-(3,4-dimethoxyphenyl)-4-oxobutanoic acid. InChIKey: BUAYFJKMVBIPKA-UHFFFAOYSA-N.
| Molecular formula | C12H14O5 |
|---|---|
| Molecular weight | 238.24 g/mol |
| IUPAC name | 4-(3,4-dimethoxyphenyl)-4-oxobutanoic acid |
| InChIKey | BUAYFJKMVBIPKA-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)C(=O)CCC(=O)O)OC |
Computed by PubChem (NCBI)