cas: 51837-85-5 — see every product listed under this CAS number, including other names
4-(3,4-dimethoxyphenyl)-1,3-thiazol-2-amine, 97%, 97% (CAS 51837-85-5) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11D94Z-5g |
| cas | 51837-85-5 |
| size | 5g |
| availability | 20g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 5g | 938.00 Pln | |
| Chemat | 10g | 1336.40 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
4-(3,4-dimethoxyphenyl)-1,3-thiazol-2-amine (CAS 51837-85-5) is a chemical compound with the molecular formula C11H12N2O2S and a molecular weight of 236.29 g/mol. IUPAC name: 4-(3,4-dimethoxyphenyl)-1,3-thiazol-2-amine. InChIKey: QNLNRENPKAQTMJ-UHFFFAOYSA-N.
| Molecular formula | C11H12N2O2S |
|---|---|
| Molecular weight | 236.29 g/mol |
| IUPAC name | 4-(3,4-dimethoxyphenyl)-1,3-thiazol-2-amine |
| InChIKey | QNLNRENPKAQTMJ-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)C2=CSC(=N2)N)OC |
Computed by PubChem (NCBI)