cas: 1004618-89-6 — see every product listed under this CAS number, including other names
4-(3,5-Difluorophenyl)piperidine hydrochloride, 97% (CAS 1004618-89-6) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 500mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F040812-250MG |
| cas | 1004618-89-6 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 1539.06 Pln | |
| Fluorochem | 500mg | 2424.16 Pln | |
| Fluorochem | 1g | 3600.83 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
4-(3,5-difluorophenyl)piperidine;hydrochloride (CAS 1004618-89-6) is a chemical compound with the molecular formula C11H14ClF2N and a molecular weight of 233.68 g/mol. IUPAC name: 4-(3,5-difluorophenyl)piperidine;hydrochloride. InChIKey: PHJMPFBDUAVODB-UHFFFAOYSA-N.
| Molecular formula | C11H14ClF2N |
|---|---|
| Molecular weight | 233.68 g/mol |
| IUPAC name | 4-(3,5-difluorophenyl)piperidine;hydrochloride |
| InChIKey | PHJMPFBDUAVODB-UHFFFAOYSA-N |
| SMILES | C1CNCCC1C2=CC(=CC(=C2)F)F.Cl |
Computed by PubChem (NCBI)