cas: 52203-73-3 — see every product listed under this CAS number, including other names
4-(3,5-Dioxo-1,2,4-triazolidin-4-yl)benzoic acid, 97%, 97% (CAS 52203-73-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch117VNP-100mg |
| cas | 52203-73-3 |
| size | 100mg |
| availability | 1.25g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 741.20 Pln | |
| Chemat | 250mg | 1197.20 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
4-(3,5-dioxo-1,2,4-triazolidin-4-yl)benzoic acid (CAS 52203-73-3) is a chemical compound with the molecular formula C9H7N3O4 and a molecular weight of 221.17 g/mol. IUPAC name: 4-(3,5-dioxo-1,2,4-triazolidin-4-yl)benzoic acid. InChIKey: ZLBYKGYCWFRLGM-UHFFFAOYSA-N.
| Molecular formula | C9H7N3O4 |
|---|---|
| Molecular weight | 221.17 g/mol |
| IUPAC name | 4-(3,5-dioxo-1,2,4-triazolidin-4-yl)benzoic acid |
| InChIKey | ZLBYKGYCWFRLGM-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(=O)O)N2C(=O)NNC2=O |
Computed by PubChem (NCBI)