cas: 10309-37-2 — see every product listed under this CAS number, including other names
4-(3,7-Dimethyl-3-vinylocta-1,6-dien-1-yl)phenol, 98%, 98% (CAS 10309-37-2) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 250g, 500g, 1kg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1144ST-1g |
| cas | 10309-37-2 |
| size | 1g |
| availability | 1000g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 198.80 Pln | |
| Chemat | 5g | 270.80 Pln | |
| Chemat | 10g | 338.00 Pln | |
| Chemat | 25g | 477.20 Pln | |
| Chemat | 250g | 976.40 Pln | |
| Chemat | 500g | 1968.00 Pln | |
| Chemat | 1kg | 3827.60 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
4-[(1E,3S)-3-ethenyl-3,7-dimethylocta-1,6-dienyl]phenol (CAS 10309-37-2) is a chemical compound with the molecular formula C18H24O and a molecular weight of 256.4 g/mol. IUPAC name: 4-[(1E,3S)-3-ethenyl-3,7-dimethylocta-1,6-dienyl]phenol. InChIKey: LFYJSSARVMHQJB-QIXNEVBVSA-N.
| Molecular formula | C18H24O |
|---|---|
| Molecular weight | 256.4 g/mol |
| IUPAC name | 4-[(1E,3S)-3-ethenyl-3,7-dimethylocta-1,6-dienyl]phenol |
| InChIKey | LFYJSSARVMHQJB-QIXNEVBVSA-N |
| SMILES | CC(=CCC[C@@](C)(C=C)/C=C/C1=CC=C(C=C1)O)C |
Computed by PubChem (NCBI)