Bakuchiol 96%
cas: 10309-37-2 — see every product listed under this CAS number, including other names
Bakuchiol 96% (CAS 10309-37-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A182762-100mg |
| cas | 10309-37-2 |
| size | 100mg |
Documents:
Safety Data Sheet (MSDS)
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 325.88 Pln | |
| Ambeed | 250mg | 381.50 Pln | |
| Ambeed | 1g | 909.94 Pln | |
| Ambeed | 5g | 2584.25 Pln |
properties
| purity | 96% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A182762 |
4-[(1E,3S)-3-ethenyl-3,7-dimethylocta-1,6-dienyl]phenol (CAS 10309-37-2) is a chemical compound with the molecular formula C18H24O and a molecular weight of 256.4 g/mol. IUPAC name: 4-[(1E,3S)-3-ethenyl-3,7-dimethylocta-1,6-dienyl]phenol. InChIKey: LFYJSSARVMHQJB-QIXNEVBVSA-N.
| Molecular formula | C18H24O |
|---|---|
| Molecular weight | 256.4 g/mol |
| IUPAC name | 4-[(1E,3S)-3-ethenyl-3,7-dimethylocta-1,6-dienyl]phenol |
| InChIKey | LFYJSSARVMHQJB-QIXNEVBVSA-N |
| SMILES | CC(=CCC[C@@](C)(C=C)/C=C/C1=CC=C(C=C1)O)C |
Computed by PubChem (NCBI)
Synonyms:
Bakuchiol, (S)-Bakuchiol, (+)-Bakuchiol, Sytenol a, 4-(3-Ethenyl-3,7-dimethyl-1,6-octadienyl)phenol, 4-[(1E,3S)-3-ethenyl-3,7-dimethylocta-1,6-dienyl]phenol, Phenol, 4-(3-ethenyl-3,7-dimethyl-1,6-octadienyl)-, (S-(E))-, 4-((1E,3S)-3-ethenyl-3,7-dimethylocta-1,6-dienyl)phenol, Backuchiol, 4-(3,7-Dimethyl-3-vinylocta-1,6-dien-1-yl)phenol