CAS 10309-37-2 appears in our catalog under these names: Bakuchiol, 96%, (S)-Bakuchiol, Bakuchiol, Bakuchiol/ 99.47% (existing batch purity), Bakuchiol, >98.0%(HPLC). Offered by: Combi-blocks, TRC, GLPBio, TargetMol, TCI. Available pack sizes: 100mg, 5g, 1g, 250mg, 20mg, 0,05g, 0,025g, 0,1g.
4-[(1E,3S)-3-ethenyl-3,7-dimethylocta-1,6-dienyl]phenol (CAS 10309-37-2) is a chemical compound with the molecular formula C18H24O and a molecular weight of 256.4 g/mol. IUPAC name: 4-[(1E,3S)-3-ethenyl-3,7-dimethylocta-1,6-dienyl]phenol. InChIKey: LFYJSSARVMHQJB-QIXNEVBVSA-N.
| Molecular formula | C18H24O |
|---|---|
| Molecular weight | 256.4 g/mol |
| IUPAC name | 4-[(1E,3S)-3-ethenyl-3,7-dimethylocta-1,6-dienyl]phenol |
| InChIKey | LFYJSSARVMHQJB-QIXNEVBVSA-N |
| SMILES | CC(=CCC[C@@](C)(C=C)/C=C/C1=CC=C(C=C1)O)C |
Computed by PubChem (NCBI)