CAS 1638221-36-9 appears in our catalog under these names: 1-[(3-bromophenyl)methyl]pyrrolidine hydrochloride, 95%, 1-(3-Bromobenzyl)pyrrolidine hydrochloride. Offered by: Combi-blocks, Biosynth. Available pack sizes: 10g, 5g, 1g, 2,5g, 0,25g.
1-[(3-bromophenyl)methyl]pyrrolidine;hydrochloride (CAS 1638221-36-9) is a chemical compound with the molecular formula C11H15BrClN and a molecular weight of 276.60 g/mol. IUPAC name: 1-[(3-bromophenyl)methyl]pyrrolidine;hydrochloride. InChIKey: LMPHVKSNLLNICD-UHFFFAOYSA-N.
| Molecular formula | C11H15BrClN |
|---|---|
| Molecular weight | 276.60 g/mol |
| IUPAC name | 1-[(3-bromophenyl)methyl]pyrrolidine;hydrochloride |
| InChIKey | LMPHVKSNLLNICD-UHFFFAOYSA-N |
| SMILES | C1CCN(C1)CC2=CC(=CC=C2)Br.Cl |
Computed by PubChem (NCBI)