CAS 2375259-03-1 is the registry number for 1-(3-Bromophenyl)piperidine hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g.
1-(3-bromophenyl)piperidine;hydrochloride (CAS 2375259-03-1) is a chemical compound with the molecular formula C11H15BrClN and a molecular weight of 276.60 g/mol. IUPAC name: 1-(3-bromophenyl)piperidine;hydrochloride. InChIKey: CTUYTAZWPFBHPE-UHFFFAOYSA-N.
| Molecular formula | C11H15BrClN |
|---|---|
| Molecular weight | 276.60 g/mol |
| IUPAC name | 1-(3-bromophenyl)piperidine;hydrochloride |
| InChIKey | CTUYTAZWPFBHPE-UHFFFAOYSA-N |
| SMILES | C1CCN(CC1)C2=CC(=CC=C2)Br.Cl |
Computed by PubChem (NCBI)