CAS 1172462-36-0 appears in our catalog under these names: 1-(4-Bromophenyl)cyclopentan-1-amine hydrochloride, 95%, 1-(4-bromophenyl)cyclopentan-1-amine hydrochloride, 1-(4-Bromophenyl)cyclopentan-1-amine hydrochloride, 97%. Offered by: Combi-blocks, Biosynth, Fluorochem. Available pack sizes: 250mg, 1g, 0,5g, 50mg, 500mg.
1-(4-bromophenyl)cyclopentan-1-amine;hydrochloride (CAS 1172462-36-0) is a chemical compound with the molecular formula C11H15BrClN and a molecular weight of 276.60 g/mol. IUPAC name: 1-(4-bromophenyl)cyclopentan-1-amine;hydrochloride. InChIKey: KDUWFLSBTKRNKX-UHFFFAOYSA-N.
| Molecular formula | C11H15BrClN |
|---|---|
| Molecular weight | 276.60 g/mol |
| IUPAC name | 1-(4-bromophenyl)cyclopentan-1-amine;hydrochloride |
| InChIKey | KDUWFLSBTKRNKX-UHFFFAOYSA-N |
| SMILES | C1CCC(C1)(C2=CC=C(C=C2)Br)N.Cl |
Computed by PubChem (NCBI)