4-(3-Chlorophenyl)cyclohexanone, 97%
cas: 1048916-71-7 — see every product listed under this CAS number, including other names
4-(3-Chlorophenyl)cyclohexanone, 97% (CAS 1048916-71-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 100mg, 5g. Offered by: Ambeed, Chemat, BLDpharm, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A304540-250mg |
| cas | 1048916-71-7 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 487.19 Pln | |
| Ambeed | 1g | 1193.62 Pln | |
| Chemat | 100mg | 242.00 Pln | |
| Chemat | 250mg | 381.20 Pln | |
| Chemat | 1g | 923.60 Pln | |
| Chemat | 5g | 3779.60 Pln | |
| BLDpharm | 100mg | 325.47 Pln | |
| BLDpharm | 250mg | 519.84 Pln | |
| BLDpharm | 1g | 1280.68 Pln | |
| Fluorochem | 100mg | 310.32 Pln | |
| Fluorochem | 250mg | 497.76 Pln | |
| Fluorochem | 5g | 5079.48 Pln | |
| Fluorochem | 1g | 1231.88 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
4-(3-chlorophenyl)cyclohexan-1-one (CAS 1048916-71-7) is a chemical compound with the molecular formula C12H13ClO and a molecular weight of 208.68 g/mol. IUPAC name: 4-(3-chlorophenyl)cyclohexan-1-one. InChIKey: SIAYFXBUBZBFJD-UHFFFAOYSA-N.
| Molecular formula | C12H13ClO |
|---|---|
| Molecular weight | 208.68 g/mol |
| IUPAC name | 4-(3-chlorophenyl)cyclohexan-1-one |
| InChIKey | SIAYFXBUBZBFJD-UHFFFAOYSA-N |
| SMILES | C1CC(=O)CCC1C2=CC(=CC=C2)Cl |
Computed by PubChem (NCBI)
Synonyms:
4-(3-chlorophenyl)cyclohexan-1-one