cas: 149986-58-3 — see every product listed under this CAS number, including other names
4-(3-Methoxybenzyl)piperidine hydrochloride, 95%, 95% (CAS 149986-58-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch112M7G-100mg |
| cas | 149986-58-3 |
| size | 100mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 184.40 Pln | |
| Chemat | 250mg | 237.20 Pln | |
| Chemat | 1g | 506.00 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
4-[(3-methoxyphenyl)methyl]piperidine;hydrochloride (CAS 149986-58-3) is a chemical compound with the molecular formula C13H20ClNO and a molecular weight of 241.76 g/mol. IUPAC name: 4-[(3-methoxyphenyl)methyl]piperidine;hydrochloride. InChIKey: IJRLNOSIZVUNGC-UHFFFAOYSA-N.
| Molecular formula | C13H20ClNO |
|---|---|
| Molecular weight | 241.76 g/mol |
| IUPAC name | 4-[(3-methoxyphenyl)methyl]piperidine;hydrochloride |
| InChIKey | IJRLNOSIZVUNGC-UHFFFAOYSA-N |
| SMILES | COC1=CC=CC(=C1)CC2CCNCC2.Cl |
Computed by PubChem (NCBI)