CAS 1212211-92-1 is the registry number for Cis-(2-amino-trans-5-phenyl-cyclohexyl)-methanol hydrochloride, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 100mg, 5g, 250mg, 1g.
[(1R,2S,5S)-2-amino-5-phenylcyclohexyl]methanol;hydrochloride (CAS 1212211-92-1) is a chemical compound with the molecular formula C13H20ClNO and a molecular weight of 241.76 g/mol. IUPAC name: [(1R,2S,5S)-2-amino-5-phenylcyclohexyl]methanol;hydrochloride. InChIKey: QVXZVWCZSJOJAP-QKWXXBCPSA-N.
| Molecular formula | C13H20ClNO |
|---|---|
| Molecular weight | 241.76 g/mol |
| IUPAC name | [(1R,2S,5S)-2-amino-5-phenylcyclohexyl]methanol;hydrochloride |
| InChIKey | QVXZVWCZSJOJAP-QKWXXBCPSA-N |
| SMILES | C1C[C@@H]([C@@H](C[C@H]1C2=CC=CC=C2)CO)N.Cl |
Computed by PubChem (NCBI)