Products 1010811-74-1
CAS 1010811-74-1 appears in our catalog under these names: (1S,2S)-2-(benzyloxy)cyclohexan-1-amine hydrochloride, 95%, (1S,2S)-2-(Benzyloxy)cyclohexanamine hydrochloride, 97%, S，S–2–BenzyloxycyclohexylaMine hydrochloride. Offered by: Combi-blocks, AmBeed, GLPBio. Available pack sizes: 25g, 100g, 5g, 1g, 250mg.
Trans-(1S,2S)-2-phenylmethoxycyclohexan-1-amine;hydrochloride (CAS 1010811-74-1) is a chemical compound with the molecular formula C13H20ClNO and a molecular weight of 241.76 g/mol. IUPAC name: trans-(1S,2S)-2-phenylmethoxycyclohexan-1-amine;hydrochloride. InChIKey: ODDBKOFUCJGDJN-QNTKWALQSA-N.
| Molecular formula | C13H20ClNO |
|---|---|
| Molecular weight | 241.76 g/mol |
| IUPAC name | trans-(1S,2S)-2-phenylmethoxycyclohexan-1-amine;hydrochloride |
| InChIKey | ODDBKOFUCJGDJN-QNTKWALQSA-N |
| SMILES | C1CC[C@@H]([C@H](C1)N)OCC2=CC=CC=C2.Cl |
Computed by PubChem (NCBI)