Products 80676-63-7

CAS 80676-63-7 is the registry number for 4-Methyl-1-benzyl-4-piperidinol hydrochloride, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 250mg, 25g.

Structural formula: {0} (CAS {1})

1-benzyl-4-methylpiperidin-4-ol;hydrochloride (CAS 80676-63-7) is a chemical compound with the molecular formula C13H20ClNO and a molecular weight of 241.76 g/mol. IUPAC name: 1-benzyl-4-methylpiperidin-4-ol;hydrochloride. InChIKey: BYVURLMYMRBUQJ-UHFFFAOYSA-N.

Identity
Molecular formulaC13H20ClNO
Molecular weight241.76 g/mol
IUPAC name1-benzyl-4-methylpiperidin-4-ol;hydrochloride
InChIKeyBYVURLMYMRBUQJ-UHFFFAOYSA-N
SMILESCC1(CCN(CC1)CC2=CC=CC=C2)O.Cl

Computed by PubChem (NCBI)