Products 1708427-93-3
CAS 1708427-93-3 appears in our catalog under these names: 4-(3-Methyl-2-oxo-2,3-dihydro-1H-imidazol-1-yl)benzoic acid, 97%, 97%, 4-(3-Methyl-2-oxo-2,3-dihydro-1H-imidazol-1-yl)benzoic acid, 97%. Offered by: Chemat, Ambeed. Available pack sizes: 50mg, 100mg, 250mg, 1g.
4-(3-methyl-2-oxoimidazol-1-yl)benzoic acid (CAS 1708427-93-3) is a chemical compound with the molecular formula C11H10N2O3 and a molecular weight of 218.21 g/mol. IUPAC name: 4-(3-methyl-2-oxoimidazol-1-yl)benzoic acid. InChIKey: XSCYIWGNYOBGMV-UHFFFAOYSA-N.
| Molecular formula | C11H10N2O3 |
|---|---|
| Molecular weight | 218.21 g/mol |
| IUPAC name | 4-(3-methyl-2-oxoimidazol-1-yl)benzoic acid |
| InChIKey | XSCYIWGNYOBGMV-UHFFFAOYSA-N |
| SMILES | CN1C=CN(C1=O)C2=CC=C(C=C2)C(=O)O |
Computed by PubChem (NCBI)