cas: 400744-83-4 — see every product listed under this CAS number, including other names
4-(3-Methylphenyl)benzaldehyde (CAS 400744-83-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F014274-100MG |
| cas | 400744-83-4 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 138.51 Pln | |
| Fluorochem | 250mg | 174.96 Pln | |
| Fluorochem | 1g | 351.98 Pln | |
| Fluorochem | 5g | 1091.30 Pln |
| delivery time | 3-4 weeks |
|---|
4-(3-methylphenyl)benzaldehyde (CAS 400744-83-4) is a chemical compound with the molecular formula C14H12O and a molecular weight of 196.24 g/mol. IUPAC name: 4-(3-methylphenyl)benzaldehyde. InChIKey: LUJIYJCRJKYCRK-UHFFFAOYSA-N.
| Molecular formula | C14H12O |
|---|---|
| Molecular weight | 196.24 g/mol |
| IUPAC name | 4-(3-methylphenyl)benzaldehyde |
| InChIKey | LUJIYJCRJKYCRK-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC=C1)C2=CC=C(C=C2)C=O |
Computed by PubChem (NCBI)