cas: 116922-22-6 — see every product listed under this CAS number, including other names
4-(3-Nitrophenyl)morpholine, 98% (CAS 116922-22-6) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F068032-1G |
| cas | 116922-22-6 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 133.30 Pln | |
| Fluorochem | 5g | 263.47 Pln | |
| Fluorochem | 10g | 456.11 Pln | |
| Fluorochem | 25g | 1060.06 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
4-(3-nitrophenyl)morpholine (CAS 116922-22-6) is a chemical compound with the molecular formula C10H12N2O3 and a molecular weight of 208.21 g/mol. IUPAC name: 4-(3-nitrophenyl)morpholine. InChIKey: DKECFAGKGYRYAT-UHFFFAOYSA-N.
| Molecular formula | C10H12N2O3 |
|---|---|
| Molecular weight | 208.21 g/mol |
| IUPAC name | 4-(3-nitrophenyl)morpholine |
| InChIKey | DKECFAGKGYRYAT-UHFFFAOYSA-N |
| SMILES | C1COCCN1C2=CC(=CC=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)