CAS 1980053-94-8 is the registry number for Methyl 2-(3-aminobicyclo[1.1.1]pent-1-yl)-1,3-oxazole-4-carboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg.
Methyl 2-(3-amino-1-bicyclo[1.1.1]pentanyl)-1,3-oxazole-4-carboxylate (CAS 1980053-94-8) is a chemical compound with the molecular formula C10H12N2O3 and a molecular weight of 208.21 g/mol. IUPAC name: methyl 2-(3-amino-1-bicyclo[1.1.1]pentanyl)-1,3-oxazole-4-carboxylate. InChIKey: YUJOUXYTZWTUCV-UHFFFAOYSA-N.
| Molecular formula | C10H12N2O3 |
|---|---|
| Molecular weight | 208.21 g/mol |
| IUPAC name | methyl 2-(3-amino-1-bicyclo[1.1.1]pentanyl)-1,3-oxazole-4-carboxylate |
| InChIKey | YUJOUXYTZWTUCV-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=COC(=N1)C23CC(C2)(C3)N |
Computed by PubChem (NCBI)