CAS 1980063-02-2 is the registry number for Methyl 3-(2-amino-1,3-oxazol-4-yl)bicyclo[1.1.1]pentane-1-carboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg.
Methyl 3-(2-amino-1,3-oxazol-4-yl)bicyclo[1.1.1]pentane-1-carboxylate (CAS 1980063-02-2) is a chemical compound with the molecular formula C10H12N2O3 and a molecular weight of 208.21 g/mol. IUPAC name: methyl 3-(2-amino-1,3-oxazol-4-yl)bicyclo[1.1.1]pentane-1-carboxylate. InChIKey: NWKUARPAEZPYPI-UHFFFAOYSA-N.
| Molecular formula | C10H12N2O3 |
|---|---|
| Molecular weight | 208.21 g/mol |
| IUPAC name | methyl 3-(2-amino-1,3-oxazol-4-yl)bicyclo[1.1.1]pentane-1-carboxylate |
| InChIKey | NWKUARPAEZPYPI-UHFFFAOYSA-N |
| SMILES | COC(=O)C12CC(C1)(C2)C3=COC(=N3)N |
Computed by PubChem (NCBI)