cas: 2057-49-0 — see every product listed under this CAS number, including other names
4-(3-Phenylpropyl)pyridine, 98%, 98% (CAS 2057-49-0) is a chemical reagent available from Chemat. Available pack sizes: 500g, 5g, 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch113AAT-500g |
| cas | 2057-49-0 |
| size | 500g |
| availability | 500g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 500g | 849.60 Pln | |
| Chemat | 5g | 93.20 Pln | |
| Chemat | 25g | 150.80 Pln | |
| Chemat | 100g | 347.60 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
4-(3-phenylpropyl)pyridine (CAS 2057-49-0) is a chemical compound with the molecular formula C14H15N and a molecular weight of 197.27 g/mol. IUPAC name: 4-(3-phenylpropyl)pyridine. InChIKey: AQIIVEISJBBUCR-UHFFFAOYSA-N.
| Molecular formula | C14H15N |
|---|---|
| Molecular weight | 197.27 g/mol |
| IUPAC name | 4-(3-phenylpropyl)pyridine |
| InChIKey | AQIIVEISJBBUCR-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CCCC2=CC=NC=C2 |
Computed by PubChem (NCBI)