CAS 444143-44-6 is the registry number for 4-(3,5-Dimethylphenyl)aniline, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
4-(3,5-dimethylphenyl)aniline (CAS 444143-44-6) is a chemical compound with the molecular formula C14H15N and a molecular weight of 197.27 g/mol. IUPAC name: 4-(3,5-dimethylphenyl)aniline. InChIKey: YJGQKYQHGKDPBF-UHFFFAOYSA-N.
| Molecular formula | C14H15N |
|---|---|
| Molecular weight | 197.27 g/mol |
| IUPAC name | 4-(3,5-dimethylphenyl)aniline |
| InChIKey | YJGQKYQHGKDPBF-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1)C2=CC=C(C=C2)N)C |
Computed by PubChem (NCBI)