cas: 87626-41-3 — see every product listed under this CAS number, including other names
4-(3-Pyridyloxy)benzaldehyde, 95%+, 95%+ (CAS 87626-41-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114K2J-100mg |
| cas | 87626-41-3 |
| size | 100mg |
| availability | 14g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 174.80 Pln | |
| Chemat | 250mg | 194.00 Pln | |
| Chemat | 1g | 414.80 Pln | |
| Chemat | 5g | 1312.40 Pln | |
| Chemat | 10g | 2565.20 Pln |
| purity | 95%+ |
|---|---|
| delivery time | 3 weeks |
4-pyridin-3-yloxybenzaldehyde (CAS 87626-41-3) is a chemical compound with the molecular formula C12H9NO2 and a molecular weight of 199.20 g/mol. IUPAC name: 4-pyridin-3-yloxybenzaldehyde. InChIKey: VNZCKMVWWJJZIL-UHFFFAOYSA-N.
| Molecular formula | C12H9NO2 |
|---|---|
| Molecular weight | 199.20 g/mol |
| IUPAC name | 4-pyridin-3-yloxybenzaldehyde |
| InChIKey | VNZCKMVWWJJZIL-UHFFFAOYSA-N |
| SMILES | C1=CC(=CN=C1)OC2=CC=C(C=C2)C=O |
Computed by PubChem (NCBI)