cas: 87626-41-3 — see every product listed under this CAS number, including other names
4-(PYRIDIN-3-YLOXY)BENZALDEHYDE (CAS 87626-41-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F306146-100MG |
| cas | 87626-41-3 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 294.71 Pln | |
| Fluorochem | 250mg | 315.53 Pln | |
| Fluorochem | 1g | 732.05 Pln | |
| Fluorochem | 5g | 2377.31 Pln |
| delivery time | 3-4 weeks |
|---|
4-pyridin-3-yloxybenzaldehyde (CAS 87626-41-3) is a chemical compound with the molecular formula C12H9NO2 and a molecular weight of 199.20 g/mol. IUPAC name: 4-pyridin-3-yloxybenzaldehyde. InChIKey: VNZCKMVWWJJZIL-UHFFFAOYSA-N.
| Molecular formula | C12H9NO2 |
|---|---|
| Molecular weight | 199.20 g/mol |
| IUPAC name | 4-pyridin-3-yloxybenzaldehyde |
| InChIKey | VNZCKMVWWJJZIL-UHFFFAOYSA-N |
| SMILES | C1=CC(=CN=C1)OC2=CC=C(C=C2)C=O |
Computed by PubChem (NCBI)